2-(4-{[(diphenylmethoxy)carbonyl]amino}-2-oxo-1,2-dihydropyrimidin-1-yl)acetic acid - Names and Identifiers
Name | (4-N-(BENZHYDRYLOXYCARBONYL)CYTOSINE)-1-ACETIC ACID
|
Synonyms | (4-N-(Benzhydryloxycarbonyl)cytosine)-1-acetic (4-N-(BENZHYDRYLOXYCARBONYL)CYTOSINE)-1-ACETIC ACID [4-N-(benzhydryloxycarbonyl)cytosin-1-yl]acetic acid 2-[4-(benzhydryloxycarbonylamino)-2-oxopyrimidin-1-yl]acetic acid (4-Benzhydryloxycarbonylamino-2-oxo-2H-pyrimidin-1-yl)-acetic acid 1(2H)-Pyrimidineacetic acid, 4-[[(diphenylmethoxy)carbonyl]amino]-2-oxo- 2-(4-(((Benzhydryloxy)carbonyl)aMino)-2-oxopyriMidin-1(2H)-yl)acetic acid [4-{[(diphenylmethoxy)carbonyl]amino}-2-oxopyrimidin-1(2H)-yl]acetic acid 2-(4-{[(diphenylmethoxy)carbonyl]amino}-2-oxo-1,2-dihydropyrimidin-1-yl)acetic acid
|
CAS | 186046-78-6
|
InChI | InChI=1/C20H17N3O5/c24-17(25)13-23-12-11-16(21-19(23)26)22-20(27)28-18(14-7-3-1-4-8-14)15-9-5-2-6-10-15/h1-12,18H,13H2,(H,24,25)(H,21,22,26,27) |
2-(4-{[(diphenylmethoxy)carbonyl]amino}-2-oxo-1,2-dihydropyrimidin-1-yl)acetic acid - Physico-chemical Properties
Molecular Formula | C20H17N3O5
|
Molar Mass | 379.37 |
Density | 1.33±0.1 g/cm3(Predicted) |
pKa | 2.95±0.10(Predicted) |
Storage Condition | 2-8°C |
Refractive Index | 1.635 |
2-(4-{[(diphenylmethoxy)carbonyl]amino}-2-oxo-1,2-dihydropyrimidin-1-yl)acetic acid - Introduction
(4-N-(BENZHYDRYLOXYCARBONYL)CYTOSINE)-1-ACETIC ACID is an organic compound whose chemical name is N-(dibenzyloxycarbonyl)-4-cytosine ACETIC ACID.
Nature:
-Appearance: Common white or yellowish solid.
-Solubility: Soluble in organic solvents, such as methanol, ethanol and dichloromethane.
-Melting point: generally between 100-110 ° C.
-Molecular weight: approximately 370.4g/mol.
Use:
(4-N-(BENZHYDRYLOXYCARBONYL)CYTOSINE)-1-ACETIC ACID is often used as an intermediate of optical materials. It can be used to synthesize organic photoelectric devices, liquid crystal materials, polymer light emitting diodes (PLED), etc. with photoelectric properties.
Method:
The method for preparing (4-N-(dibenzyloxycarbonyl)-cytosine)-1-acetic acid is complicated and generally requires a multi-step reaction. The specific preparation method needs to be designed and optimized according to actual needs.
Safety Information:
Due to the lack of specific security data, the information available is limited. For any chemical substances, strict laboratory safety procedures should be followed and appropriate personal protective equipment, such as gloves, goggles, etc., should be worn when using. At the same time, avoid direct contact with the skin and eyes, avoid inhaling its vapor or dust. If exposed or inhaled, immediately wash skin or remove from air and seek medical attention.
Last Update:2024-04-09 21:11:58